tris(3-methylphenyl) phosphate


m-tolyl phosphate; tri-m-cresyl phosphate; tris(3-methylphenyl) phosphate; tri-m-tolyl phosphate; tri-m-tolylphosphate
Links:📖 PubMed
CAS RN:[563-04-2]
Formula:C21H21O4P; 368.37 g/mol
InChiKey:RMLPZKRPSQVRAB-UHFFFAOYSA-N
SMILES:Cc1cccc(O[P](=O)(Oc2cccc(C)c2)Oc3cccc(C)c3)c1
Molecular structure of tris(3-methylphenyl) phosphate
Dipole moment:3.05 D
Melting point:26 °C

Isomers

isopropylphenyl diphenyl phosphate
Molecular structure of isopropylphenyl diphenyl phosphate
tricresyl phosphate
Molecular structure of tricresyl phosphate
tris(2-methylphenyl) phosphate
Molecular structure of tris(2-methylphenyl) phosphate
tris(3-methylphenyl) phosphate
Molecular structure of tris(3-methylphenyl) phosphate